This chemical is called 3-Azidopropanoic acid, and it's also named as Azidopropionic acid. With the molecular formula of C₃H₅N₃O₂, its molecular weight is 115.09. The CAS registry number of this chemical is 79583-67-8.

Other characteristics of the 3-Azidopropanoic acid can be summarised as followings: (1)ACD/LogP: 0.00; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.44; (4)ACD/LogD (pH 7.4): -3.19; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 5; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 38.66 Å².

You can still convert the following datas into molecular structure: 
1.SMILES: [N-]=[N+]=N\CCC(=O)O
2.InChI: InChI=1/C3H5N3O2/c4-6-5-2-1-3(7)8/h1-2H2,(H,7,8)
3.InChIKey: YIPVUXAMZQBALD-UHFFFAOYAI