The 3-Pyridinol, 5-phenyl-, with the CAS registry number 31676-55-8, is also known as 3-Hydroxy-5-phenylpyridine. This chemical's molecular formula is C₁₁H₉NO and molecular weight is 171.2. Its systematic name is called 5-phenylpyridin-3-ol.

Physical properties of 3-Pyridinol, 5-phenyl-: (1)ACD/LogP: 2.56; (2)ACD/LogD (pH 5.5): 2.37; (3)ACD/LogD (pH 7.4): 2.36; (4)ACD/BCF (pH 5.5): 33.74; (5)ACD/BCF (pH 7.4): 32.83; (6)ACD/KOC (pH 5.5): 381.32; (7)ACD/KOC (pH 7.4): 371.01; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.611; (12)Molar Refractivity: 50.81 cm³; (13)Molar Volume: 146.3 cm³; (14)Surface Tension: 50.2 dyne/cm; (15)Density: 1.169 g/cm³; (16)Flash Point: 214.3 °C; (17)Enthalpy of Vaporization: 71.27 kJ/mol; (18)Boiling Point: 430.7 °C at 760 mmHg; (19)Vapour Pressure: 5.06E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: Oc2cc(c1ccccc1)cnc2
(2)InChI: InChI=1/C11H9NO/c13-11-6-10(7-12-8-11)9-4-2-1-3-5-9/h1-8,13H
(3)InChIKey: NUTMKQSGPRZCAU-UHFFFAOYAW