The 4-Pyridinecarbonitrile,1,2-dihydro-2-oxo- is an organic compound with the formula C₆H₄N₂O. The systematic name of this chemical is 2-oxo-1,2-dihydropyridine-4-carbonitrile. With the CAS registry number 94805-51-3, it is also named as 5-Fluoro-2,3-dihydro-(1H)-indole. The product's categories are Nitrile; Blocks; Pyridines. In addition, the molecular weight is 120.11. 

The other characteristics of 4-Pyridinecarbonitrile,1,2-dihydro-2-oxo- can be summarized as: (1)ACD/LogP: -0.89; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -0.89; (4)ACD/LogD (pH 7.4): -0.89; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 7.81; (8)ACD/KOC (pH 7.4): 7.81; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 44.1 Å²; (13)Index of Refraction: 1.571; (14)Molar Refractivity: 31.08 cm³; (15)Molar Volume: 94.4 cm³; (16)Polarizability: 12.32×10^-24 cm³; (17)Surface Tension: 53 dyne/cm; (18)Density: 1.27 g/cm³; (19)Flash Point: 155 °C; (20)Enthalpy of Vaporization: 57.55 kJ/mol; (21)Boiling Point: 332.7 °C at 760 mmHg; (22)Vapour Pressure: 0.000143 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:N#CC=1\C=C/NC(=O)C=1
2. InChI:InChI=1/C6H4N2O/c7-4-5-1-2-8-6(9)3-5/h1-3H,(H,8,9) 
3. InChIKey:QCOIIYBOBZFBJE-UHFFFAOYAB
4. Std. InChI:InChI=1S/C6H4N2O/c7-4-5-1-2-8-6(9)3-5/h1-3H,(H,8,9) 
5. Std. InChIKey:QCOIIYBOBZFBJE-UHFFFAOYSA-N