The CAS registry number of 5-Pyrimidinecarbonitrile,2,4-diamino-6-methyl- is 7466-13-9. It belongs to the product category of Pyrimidine. The molecular formula of it is C₆H₇N₅ and molecular weight is 149.15328. Its systematic name and IUPAC name are the same which is called 2,4-diamino-6-methylpyrimidine-5-carbonitrile.

Physical properties about this chemical are: (1)ACD/LogP: 0.29; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 4; (5)#Freely Rotating Bonds: 0; (6)Index of Refraction: 1.631; (7)Molar Refractivity: 38.77 cm³; (8)Molar Volume: 108.7 cm³; (9)Surface Tension: 93.5 dyne/cm; (10)Density: 1.37 g/cm³; (11)Flash Point: 245 °C; (12)Enthalpy of Vaporization: 74.62 kJ/mol; (13)Boiling Point: 481.5 °C at 760 mmHg.

You can still convert the following datas into molecular structure:
(1)SMILES: N#Cc1c(nc(nc1C)N)N
(2)InChI: InChI=1/C6H7N5/c1-3-4(2-7)5(8)11-6(9)10-3/h1H3,(H4,8,9,10,11)
(3)InChIKey: ROEHHIZFOGEJRN-UHFFFAOYAL