The cas register number of 7-Bromo-2-methyl-2H-indazole is 701910-14-7. It also can be called as 2H-Indazole,7-bromo-2-methyl- and the IUPAC Name about this chemical is 7-bromo-2-methylindazole. It belongs to the following product categories, such as Indazole, Organohalides and so on.

Physical properties about 701910-14-7 are: (1)ACD/LogP: 2.58; (2)ACD/LogD (pH 5.5): 2.58; (3)ACD/LogD (pH 7.4): 2.58; (4)ACD/BCF (pH 5.5): 53.96; (5)ACD/BCF (pH 7.4): 53.96; (6)ACD/KOC (pH 5.5): 604.58; (7)ACD/KOC (pH 7.4): 604.58; (8)#H bond acceptors: 2; (9)Polar Surface Area: 17.82Ų; (10)Index of Refraction: 1.663; (11)Molar Refractivity: 48.69 cm³; (12)Molar Volume: 131.3 cm³; (13)Polarizability: 19.3x10^-24cm³; (14)Surface Tension: 46.7 dyne/cm; (15)Enthalpy of Vaporization: 54.21 kJ/mol; (16)Vapour Pressure: 0.000518 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CN1C=C2C=CC=C(C2=N1)Br
(2)InChI: InChI=1S/C8H7BrN2/c1-11-5-6-3-2-4-7(9)8(6)10-11/h2-5H,1H3
(3)InChIKey: KPAYIFGPJOYWMM-UHFFFAOYSA-N