The Adipic acid, magnesium salt (1:1), with the CAS registry number 7486-39-7, is also known as Hexanedioic acid, magnesium salt (1:1). This chemical's molecular formula is C₆H₈MgO₄ and molecular weight is 168.43032. What's more, its IUPAC name and systematic name are the same which is called Magnesium hexanedioate.

Physical properties about Adipic acid, magnesium salt (1:1) are: (1)ACD/LogP: 0.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -1.56; (4)ACD/LogD (pH 7.4): -4.54; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 1; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 4; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 5; (12) Polar Surface Area: 74.6 Å²; (13)Flash Point: 172.7 °C; (14)Enthalpy of Vaporization: 63.95 kJ/mol; (15)Boiling Point: 338.5 °C at 760 mmHg; (16)Vapour Pressure: 1.81E-05 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: [Mg+2].[O-]C(=O)CCCCC(=O)[O-]
(2) InChI: InChI=1/C6H10O4.Mg/c7-5(8)3-1-2-4-6(9)10;/h1-4H2,(H,7,8)(H,9,10);/q;+2/p-2
(3) InChIKey: QXNFATVALXHNRJ-NUQVWONBAG

The toxicity data is as follows: