The Benzothiazolium,2,3-dimethyl-, iodide (1:1) is an organic compound with the molecular formula C₉H₁₀INS. Its CAS registry number is 2785-06-0. The IUPAC name of this chemical is called 2,3-Dimethyl-1,3-benzothiazol-3-ium iodide. What's more, the molecular weight of this chemical is 291.15187.

Physical properties about tBenzothiazolium,2,3-dimethyl-, iodide (1:1) are: (1)#H bond acceptors: 1; (2)#H bond donors: 0; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 32.12 Å².

Preparation of Benzothiazolium,2,3-dimethyl-, iodide (1:1): this chemical can be prepared by 2-methyl-benzothiazole with iodomethane. This reaction needs solvent nitromethane at temperature of 70 °C. The reaction time is 24 hours. The yield is 93 %. The reaction equation is as followed:

Uses of Benzothiazolium,2,3-dimethyl-, iodide (1:1): it can be used to produce other chemicals. For example, it is used to produce 2-[3-(dimethylhydrazono)-1-propenyl]-3-methylbenzothiazolium-iodid with glyoxal mono-dimethylhydrazone. The reaction occurs with reagent Et₃N, solvent ethanol and other condition of heating for 5 min. The yield is 90 %. The reaction equation is as followed:

You can still convert the following datas into molecular structure:
(1) SMILES: [I-].s2c1ccccc1[n+](c2C)C
(2) InChI: InChI=1/C9H10NS.HI/c1-7-10(2)8-5-3-4-6-9(8)11-7;/h3-6H,1-2H3;1H/q+1;/p-1
(3) InChIKey: VZRIFNLQJXPRJI-REWHXWOFAO