The Chrysanthemoyl chloride with the cas number 14297-81-5 is also called Cyclopropanecarbonylchloride, 2,2-dimethyl-3-(2-methyl-1-propen-1-yl)-. The IUPAC name is 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carbonyl chloride. Its molecular formula is C₁₀H₁₅ClO. The EINECS registry number is 238-229-5.

The properties of the chemical are: (1)ACD/LogP: 3.55; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.55; (4)ACD/LogD (pH 7.4): 3.55; (5)ACD/BCF (pH 5.5): 295.53; (6)ACD/BCF (pH 7.4): 295.53; (7)ACD/KOC (pH 5.5): 2042.05; (8)ACD/KOC (pH 7.4): 2042.05; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 17.07 Å²; (13)Index of Refraction: 1.533; (14)Molar Refractivity: 52.79 cm³; (15)Molar Volume: 169.9 cm³; (16)Polarizability: 20.93×10^-24cm³; (17)Surface Tension: 37.6 dyne/cm; (18)Enthalpy of Vaporization: 44.22 kJ/mol; (19)Vapour Pressure: 0.243 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: ClC(=O)C1C(/C=C(/C)C)C1(C)C
(2)InChI: InChI=1/C10H15ClO/c1-6(2)5-7-8(9(11)12)10(7,3)4/h5,7-8H,1-4H3
(3)InChIKey: VNTCVNLNEOVBEE-UHFFFAOYAC

The toxicity data is as follows: