The Cyclohexane,1,2-dichloro-, (1R,2S)-rel- with CAS registry number of 10498-35-8 is also known as cis-1,2-Dichlorocyclohexane. The IUPAC name is (1R,2S)-1,2-Dichlorocyclohexane. In addition, the formula is C₆H₁₀Cl₂ and the molecular weight is 153.05.

Physical properties about Cyclohexane,1,2-dichloro-, (1R,2S)-rel- are: (1)ACD/LogP: 3.06; (2)ACD/LogD (pH 5.5): 3.06; (3)ACD/LogD (pH 7.4): 3.06; (4)ACD/BCF (pH 5.5): 125.03; (5)ACD/BCF (pH 7.4): 125.03; (6)ACD/KOC (pH 5.5): 1103.17; (7)ACD/KOC (pH 7.4): 1103.17; (8)Index of Refraction: 1.472; (9)Molar Refractivity: 37.4 cm³; (10)Molar Volume: 133.4 cm³; (11)Surface Tension: 30.8 dyne/cm; (12)Density: 1.14 g/cm³; (13)Flash Point: 66.1 °C; (14)Enthalpy of Vaporization: 42.51 kJ/mol; (15)Boiling Point: 206.9 °C at 760 mmHg; (16)Vapour Pressure: 0.333 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
1. Canonical SMILES: C1CCC(C(C1)Cl)Cl
2. Isomeric SMILES: C1CC[C@@H]([C@@H](C1)Cl)Cl
3. InChI: InChI=1S/C6H10Cl2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6+
4. InChIKey: GZEZIBFVJYNETN-OLQVQODUSA-N