The D-Fructose phenylosazone, with the CAS registry number 534-97-4, is also known as D-Glucose phenylosazone. Its EINECS number is 208-607-4. This chemical's molecular formula is C₁₈H₂₂N₄O₄ and molecular weight is 358.39. What's more, its systematic name is (5Z,6E)-5,6-bis(phenylhydrazono)hexane-1,2,3,4-tetrol (non-preferred name).

Physical properties of D-Fructose phenylosazone are: (1)ACD/LogP: 1.95; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 8; (4)#H bond donors: 6; (5)#Freely Rotating Bonds: 13; (6)Polar Surface Area: 68.12 Å²; (7)Index of Refraction: 1.62; (8)Molar Refractivity: 96.02 cm³; (9)Molar Volume: 273.2 cm³; (10)Polarizability: 38.06×10^-24cm³; (11)Surface Tension: 54.2 dyne/cm; (12)Density: 1.31 g/cm³; (13)Flash Point: 336.1 °C; (14)Enthalpy of Vaporization: 98.25 kJ/mol; (15)Boiling Point: 632.2 °C at 760 mmHg; (16)Vapour Pressure: 7.53E-17 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: N(=C(/C=N/Nc1ccccc1)C(O)C(O)C(O)CO)\Nc2ccccc2
(2)Std. InChI: InChI=1S/C18H22N4O4/c23-12-16(24)18(26)17(25)15(22-21-14-9-5-2-6-10-14)11-19-20-13-7-3-1-4-8-13/h1-11,16-18,20-21,23-26H,12H2/b19-11+,22-15-
(3)Std. InChIKey: BZVNQJMWJJOFFB-QITQYTSXSA-N