The DL-Glutamic acid, 4-(1-piperidinyl)-, diastereomer A, with the CAS registry number 32899-77-7, is also known as 4-(1-Piperidinyl)-L-glutamic acid. This chemical's molecular formula is C₁₀H₁₈N₂O₄ and molecular weight is 230.26. What's more, its systematic name is (2S)-2-amino-4-(piperidin-1-yl)pentanedioic acid. Its classification code is Drug/Therapeutic Agent. 

Physical properties of DL-Glutamic acid, 4-(1-piperidinyl)-, diastereomer A are: (1)ACD/LogP: 0.64; (2)# of Rule of 5 Violations: 0; (3)ACD/BCF (pH 5.5): 1; (4)ACD/KOC (pH 5.5): 1; (5)#H bond acceptors: 6; (6)#H bond donors: 4; (7)#Freely Rotating Bonds: 6; (8)Polar Surface Area: 59.08 Å²; (9)Index of Refraction: 1.553; (10)Molar Refractivity: 56.37 cm³; (11)Molar Volume: 175.9 cm³; (12)Polarizability: 22.35×10^-24cm³; (13)Surface Tension: 63.8 dyne/cm; (14)Density: 1.308 g/cm³; (15)Flash Point: 210.8 °C; (16)Enthalpy of Vaporization: 74.52 kJ/mol; (17)Boiling Point: 424.9 °C at 760 mmHg; (18)Vapour Pressure: 2.07E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)[C@@H](N)CC(C(=O)O)N1CCCCC1
(2)InChI: InChI=1S/C10H18N2O4/c11-7(9(13)14)6-8(10(15)16)12-4-2-1-3-5-12/h7-8H,1-6,11H2,(H,13,14)(H,15,16)/t7-,8?/m0/s1
(3)InChIKey: YIKWBGMEIPZPAQ-JAMMHHFISA-N

The toxicity data is as follows: