The Eprosartan mesylate, with the CAS registry number 144143-96-4, is also known as Eprosartan mesylate dihydrate. It belongs to the product category of Eprosartan. This chemical's molecular formula is C₂₄H₂₈N₂O₇S₂ and molecular weight is 520.61832. Its IUPAC name is called 4-[[2-butyl-5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]benzoic acid; methanesulfonic acid. What's more, this chemical's classification code is Antihypertensive.

Physical properties of Eprosartan mesylate: (1)ACD/LogP: 4.96; (2)ACD/LogD (pH 5.5): 1.64; (3)ACD/LogD (pH 7.4): 1.37; (4)ACD/BCF (pH 5.5): 1.66; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 5.7; (7)ACD/KOC (pH 7.4): 3.08; (8)#H bond acceptors: 6; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 10; (11)Flash Point: 353.3 °C; (12)Enthalpy of Vaporization: 102.14 kJ/mol; (13)Boiling Point: 660.6 °C at 760 mmHg; (14)Vapour Pressure: 2.37E-18 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)C=C(CC3=CC=CS3)C(=O)O.CS(=O)(=O)O
(2)Isomeric SMILES: CCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)/C=C(\CC3=CC=CS3)/C(=O)O.CS(=O)(=O)O
(3)InChI: InChI=1S/C23H24N2O4S.CH4O3S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27;1-5(2,3)4/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29);1H3,(H,2,3,4)/b18-12+
(4)InChIKey: DJSLTDBPKHORNY-XMMWENQYSA-N