The Hydrazinecarboxamide,N-(4-chlorophenyl)- with CAS registry number of 69194-89-4 is also known as Semicarbazide,4-(p-chlorophenyl)- (7CI). The systematic name is N-(4-Chlorophenyl)hydrazine carboxamide. In addition, the formula is C₇H₈ClN₃O and the molecular weight is 185.61.

Physical properties about Hydrazinecarboxamide,N-(4-chlorophenyl)- are: (1)ACD/LogP: 0.87; (2)ACD/LogD (pH 5.5): 0.87; (3)ACD/LogD (pH 7.4): 0.87; (4)ACD/BCF (pH 5.5): 2.69; (5)ACD/BCF (pH 7.4): 2.69; (6)ACD/KOC (pH 5.5): 70.57; (7)ACD/KOC (pH 7.4): 70.73; (8)#H bond acceptors: 4; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.655; (12)Molar Refractivity: 47.91 cm³; (13)Molar Volume: 130.4 cm³; (14)Surface Tension: 60.6 dyne/cm; (15)Density: 1.422 g/cm³.

Preparation of Hydrazinecarboxamide,N-(4-chlorophenyl)-: it is prepared by reaction of 3-(4-chloro-phenyl)-5-(4-methoxy-benzylidene)-thiazolidine-2,4-dione. The reaction needs reagent 99% N₂H₄*H₂O and solvent ethanol with other condition of heating for 12 hours. The yield is about 50%.

Uses of Hydrazinecarboxamide,N-(4-chlorophenyl)-: it is used to produce NSC 680933 by condensation reaction with naphthalene-1-carbaldehyde. The reaction occurs with solvent ethanol with other condition of heating. The yield is about 59%.

You can still convert the following datas into molecular structure:
1. SMILES: Clc1ccc(NC(=O)NN)cc1
2. InChI: InChI=1/C7H8ClN3O/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12)
3. InChIKey: OXFKGEPYTJGZOZ-UHFFFAOYAM
4. Std. InChI: InChI=1S/C7H8ClN3O/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12)
5. Std. InChIKey: OXFKGEPYTJGZOZ-UHFFFAOYSA-N