The Methyl 2,5-dichloroisonicotinate is an organic compound with the formula C₇H₅Cl₂NO₂. The systematic name of this chemical is methyl 2,5-dichloropyridine-4-carboxylate. With the CAS registry number 623585-74-0, it is also named as 4-pyridinecarboxylic acid, 2,5-dichloro-, methyl ester. In addition, the molecular weight is 206.03.

The other characteristics of Methyl 2,5-dichloroisonicotinate can be summarized as: (1)ACD/LogP: 2.08; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.08; (4)ACD/LogD (pH 7.4): 2.08; (5)#H bond acceptors: 3; (6)#H bond donors: 0; (7)#Freely Rotating Bonds: 2; (8)Polar Surface Area: 39.19 Å²; (9)Index of Refraction: 1.548; (10)Molar Refractivity: 45.9 cm³; (11)Molar Volume: 144.4 cm³; (12)Polarizability: 18.19×10^-24 cm³; (13)Surface Tension: 46.8 dyne/cm; (14)Density: 1.426 g/cm³; (15)Flash Point: 120.3 °C; (16)Enthalpy of Vaporization: 51.37 kJ/mol; (17)Boiling Point: 275.2 °C at 760 mmHg; (18)Vapour Pressure: 0.00515 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:O=C(OC)c1cc(Cl)ncc1Cl
2. InChI:InChI=1/C7H5Cl2NO2/c1-12-7(11)4-2-6(9)10-3-5(4)8/h2-3H,1H3
3. InChIKey:OJTXNNHRMCEWAM-UHFFFAOYAQ
4. Std. InChI:InChI=1S/C7H5Cl2NO2/c1-12-7(11)4-2-6(9)10-3-5(4)8/h2-3H,1H3
5. Std. InChIKey:OJTXNNHRMCEWAM-UHFFFAOYSA-N