The Nitric acid; plutonium, with the CAS registry number 59568-66-0, is also known as 2-(p-Tolyl)thiazole. This chemical's molecular formula is C₁₀H₉NS and molecular weight is 175.2502. Its systematic name is called 2-(4-methylphenyl)-1,3-thiazole.

Physical properties of Nitric acid; plutonium: (1)ACD/LogP: 3.70; (2)ACD/LogD (pH 5.5): 3.7; (3)ACD/LogD (pH 7.4): 3.7; (4)ACD/BCF (pH 5.5): 381.22; (5)ACD/BCF (pH 7.4): 381.59; (6)ACD/KOC (pH 5.5): 2449.56; (7)ACD/KOC (pH 7.4): 2451.92; (8)#H bond acceptors: 1; (9)#Freely Rotating Bonds: 1; (10)Index of Refraction: 1.593; (11)Molar Refractivity: 52.14 cm³; (12)Molar Volume: 153.6 cm³; (13)Surface Tension: 43.8 dyne/cm; (14)Density: 1.14 g/cm³; (15)Flash Point: 132.3 °C; (16)Enthalpy of Vaporization: 50.82 kJ/mol; (17)Boiling Point: 290.1 °C at 760 mmHg; (18)Vapour Pressure: 0.00368 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: n1ccsc1c2ccc(cc2)C
(2)InChI: InChI=1/C10H9NS/c1-8-2-4-9(5-3-8)10-11-6-7-12-10/h2-7H,1H3
(3)InChIKey: LHXIZCFNFNHOPM-UHFFFAOYAB