The synthesis of these furanone derivatives can be used in the development of functional materials, such as polymers with specific properties, or as components in the manufacture of advanced coatings or adhesives.
If you need to purchase chemical raw materials, submit your demand information to get the latest quotations.
4-(4-nitrophenyl)-3-phenylfuran-2(5H)-one
benzyl 5-bromo-2-[(4-methoxyphenyl)ethynyl]phenylcarbamate
FB(CH(C4N(CH3)2CH2CH3)2)(1+)*B(C6F5)4(1-)=[FB(CH(C4N(CH3)2CH2CH3)2)][B(C6F5)4]
[(n-Bu2Sn)2(4-carboxyphenylcarbamoyl)benzoate]2*toluene
(3,5-Diformyl-4-phenyl-4H-pyridin-1-yl)-acetic acid methyl ester
