The CAS registry number of a-D-Glucopyranose,2-(acetylamino)-2,4-dideoxy-4-fluoro- is 129728-87-6. This chemical's molecular formula is C₈H₁₄FNO₅ and molecular weight is 223.199. Its systematic name is called N-[(2S,3S,4R,5S)-5-fluoro-2,4-dihydroxy-6-(hydroxymethyl)tetrahydropyran-3-yl]acetamide. What's more, this chemical can be used as inhibitor of hepatic glycosaminoglycan biosynthesis.

Physical properties of a-D-Glucopyranose,2-(acetylamino)-2,4-dideoxy-4-fluoro-: (1)ACD/BCF (pH 5.5): 1; (2)ACD/BCF (pH 7.4): 1; (3)ACD/KOC (pH 5.5): 5.607; (4)ACD/KOC (pH 7.4): 5.607; (5)#H bond acceptors: 6; (6)#H bond donors: 4; (7)#Freely Rotating Bonds: 5; (8)Index of Refraction: 1.523; (9)Molar Refractivity: 47.161 cm³; (10)Molar Volume: 154.502 cm³; (11)Surface Tension: 57.034 dyne/cm; (12)Density: 1.445 g/cm³; (13)Flash Point: 290.592 °C; (14)Enthalpy of Vaporization: 96.366 kJ/mol; (15)Boiling Point: 556.882 °C at 760 mmHg; (16)Vapour Pressure: 0 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: CC(=O)N[C@H]1[C@H]([C@@H](C(O[C@@H]1O)CO)F)O
(2)InChI: InChI=1/C8H14FNO5/c1-3(12)10-6-7(13)5(9)4(2-11)15-8(6)14/h4-8,11,13-14H,2H2,1H3,(H,10,12)/t4?,5-,6+,7+,8+/m1/s1
(3)InChIKey: QAPRNMNSFDDVPY-QVAPDBTGBU