131598-62-4 Usage
General Description
L-isoleucine is an essential amino acid that plays a crucial role in protein synthesis and muscle metabolism. As a branched-chain amino acid (BCAA), it is involved in the repair and growth of muscle tissues, making it a popular ingredient in sports supplements and muscle-building products. L-isoleucine also supports the regulation of blood sugar levels and energy production, making it beneficial for athletes and individuals engaging in physical activities. Additionally, it is essential for the production of hemoglobin and the regulation of nitrogen levels in the body. Overall, L-isoleucine is an important nutrient for maintaining muscle health, energy levels, and overall physical performance.
Check Digit Verification of cas no
The CAS Registry Mumber 131598-62-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,5,9 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 131598-62:
(8*1)+(7*3)+(6*1)+(5*5)+(4*9)+(3*8)+(2*6)+(1*2)=134
134 % 10 = 4
So 131598-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1
131598-62-4Relevant articles and documents
3,7-DIALKYL-8-ALKYL- OR -ARYL-3,7-DIHYDROPURINE-2,6-DIONES
Rybar, Alfonz,Hesek, Dusan,Szemes, Fridrich,Alfoeldi, Juraj,Tegza, Marian
, p. 2257 - 2269 (2007/10/02)
3,7-Dialkyl-8-alkyl- or -aryl-3,7-dihydropurine-2,6-diones XII-XIV were synthesized from 5-alkylamino-6-amino-1-alkyl-2,4(1H, 3H)-pyrimidinediones VII-IX by three methods: the first is based upon an acid catalyzed cyclization of the starting derivatives V