132464-59-6 Usage
Description
3-[4-(2-Chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-2-yl]-2-propyn-1-ol is a complex organic compound characterized by its unique molecular structure. It is a yellow solid with potential applications in the pharmaceutical industry due to its chemical properties.
Uses
Used in Pharmaceutical Industry:
3-[4-(2-Chlorophenyl)-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-2-yl]-2-propyn-1-ol is used as a Platelet-activating factor (PAF) antagonist for its ability to inhibit the action of PAF, which plays a role in various physiological processes and is involved in the pathogenesis of several diseases.
Additionally, it is used as an intermediate in the preparation of antiarrhythmics, which are medications designed to regulate abnormal heart rhythms. Its unique chemical structure allows it to be a valuable component in the synthesis of these drugs, potentially improving their efficacy and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 132464-59-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,4,6 and 4 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 132464-59:
(8*1)+(7*3)+(6*2)+(5*4)+(4*6)+(3*4)+(2*5)+(1*9)=116
116 % 10 = 6
So 132464-59-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H13ClN4OS/c1-11-21-22-16-10-20-17(13-6-2-3-7-15(13)19)14-9-12(5-4-8-24)25-18(14)23(11)16/h2-3,6-7,9,24H,8,10H2,1H3
132464-59-6Relevant articles and documents
Thienotriazolodiazepines as platelet-activating factor antagonists. Steric limitations for the substituent in position 2
Walser,Flynn,Mason,Crowley,Maresca,O'Donnell
, p. 1440 - 1446 (2007/10/02)
The preparations of thienotriazolodiazepines bearing a substituted ethynyl group at the 2-position, and the corresponding cis-olefins and fully saturated analogues are described. The compounds were evaluated as potential antagonists of platelet-activating