138564-60-0 Usage
Description
4-Amino-2-methyl-10H-thiene[2,3-b][1,5]benzodiazepine hydrochloride is an organic compound that serves as an intermediate in the synthesis of Olanzapine, a widely used antipsychotic medication. It is a yellow crystalline solid with unique chemical properties that make it a valuable component in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
4-Amino-2-methyl-10H-thiene[2,3-b][1,5]benzodiazepine hydrochloride is used as an intermediate in the preparation of Olanzapine (O253750) for its role in the synthesis of antipsychotic drugs. The compound plays a crucial part in the development of medications that help manage and treat various mental health disorders, such as schizophrenia and bipolar disorder.
As an intermediate, 4-Amino-2-methyl-10H-thiene[2,3-b][1,5]benzodiazepine hydrochloride contributes to the overall chemical structure of Olanzapine, which is known for its effectiveness in treating the symptoms of psychotic conditions. Its presence in the synthesis process is essential for the production of a drug that can provide relief and improve the quality of life for patients suffering from these disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 138564-60-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,5,6 and 4 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 138564-60:
(8*1)+(7*3)+(6*8)+(5*5)+(4*6)+(3*4)+(2*6)+(1*0)=150
150 % 10 = 0
So 138564-60-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2.ClH/c1-2-6-9-8(4-1)5-3-7-10-11-9;/h1-7,11H;1H
