1435-52-5 Usage
Description
1,4-DIBROMO-2-FLUOROBENZENE is an organic compound with the chemical formula C6H2Br2F. It is a white crystalline mass that is characterized by its distinct chemical properties, which make it suitable for various applications in different industries.
Uses
Used in Chemical Synthesis:
1,4-DIBROMO-2-FLUOROBENZENE is used as a chemical intermediate for the preparation of various organic compounds. For example, it is used in the synthesis of 1,4-bis(2-hydroxy-2-methyl-3-butynyl)-2-fluorobenzene, which can be further utilized in the development of new materials and pharmaceuticals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,4-DIBROMO-2-FLUOROBENZENE is used as a key building block for the development of new drugs. Its unique chemical structure allows for the creation of novel molecules with potential therapeutic applications.
Used in Material Science:
1,4-DIBROMO-2-FLUOROBENZENE is used as a starting material for the synthesis of fluorinated para-terphenyls through the Suzuki-Miyaura reaction with arylboronic acids. These fluorinated para-terphenyls have potential applications in the development of advanced materials with specific properties, such as improved thermal stability or enhanced electrical conductivity.
Used in Research and Development:
Due to its unique chemical properties, 1,4-DIBROMO-2-FLUOROBENZENE is also used in research and development for the exploration of new chemical reactions and the discovery of novel compounds with potential applications in various industries, including pharmaceuticals, materials science, and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 1435-52-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,3 and 5 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1435-52:
(6*1)+(5*4)+(4*3)+(3*5)+(2*5)+(1*2)=65
65 % 10 = 5
So 1435-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Br2F/c7-4-1-2-5(8)6(9)3-4/h1-3H
1435-52-5Relevant articles and documents
Preparation process of fluorine substituted aromatic compound
-
, (2008/06/13)
A preparation process of a fluorine substituted aromatic compound comprising reacting an alkali metal or alkali earth metal salt of an aromatic compound having a hydroxy group with an organic fluorinating agent is disclosed. As a representative fluorinating agent, a bis-dialkylamino-difluoromethane compound, for example, 2,2′-difluoro-1,3-dimethylimidazolidine, is exemplified. According to the process, an industrially useful fluorinated aromatic compound, for example, a fluorobenzene, a fluorine substituted benzophenone, a fluorine substituted diarylsulfone can be prepared with ease in economy without specific equipment.