176977-85-8 Usage
Description
Methyl 4-chloro-2-pyridinecarboxylate hydrochloride, with the CAS number 176977-85-8, is a light yellow solid compound that is primarily used in organic synthesis. It is a derivative of pyridine, a nitrogen-containing heterocyclic compound, and has a chlorine atom at the 4th position and a methyl ester group at the 2nd position.
Uses
Used in Organic Synthesis:
Methyl 4-chloro-2-pyridinecarboxylate hydrochloride is used as an intermediate in the synthesis of various organic compounds. Its unique chemical structure allows it to be a versatile building block for the creation of a wide range of molecules with different applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Methyl 4-chloro-2-pyridinecarboxylate hydrochloride is used as a key component in the development of new drugs. Its chemical properties make it suitable for the synthesis of various drug candidates, particularly those targeting neurological disorders, inflammation, and other conditions.
Used in Chemical Research:
Methyl 4-chloro-2-pyridinecarboxylate hydrochloride is also utilized in chemical research for studying the properties and reactivity of pyridine derivatives. This helps researchers understand the behavior of these compounds and develop new methods for their synthesis and application.
Used in Agrochemical Industry:
In the agrochemical industry, Methyl 4-chloro-2-pyridinecarboxylate hydrochloride is employed as a starting material for the synthesis of various agrochemicals, such as pesticides and herbicides. Its unique structure allows for the development of new compounds with improved efficacy and selectivity.
Used in Material Science:
Methyl 4-chloro-2-pyridinecarboxylate hydrochloride is also used in the field of material science for the development of new materials with specific properties. Its incorporation into polymers and other materials can lead to the creation of materials with enhanced properties, such as improved stability, conductivity, or other desired characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 176977-85-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,6,9,7 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 176977-85:
(8*1)+(7*7)+(6*6)+(5*9)+(4*7)+(3*7)+(2*8)+(1*5)=208
208 % 10 = 8
So 176977-85-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H6ClNO2.ClH/c1-11-7(10)6-4-5(8)2-3-9-6;/h2-4H,1H3;1H
176977-85-8Relevant articles and documents
Improved large-scale preparation of 4-iodopicolinic acid
Lohse, Olivier
, p. 2017 - 2025 (1996)
Dimethylformamide showed a dramatic catalytic effect in the chlorination of picolinic acid with thionyl chloride. Methyl 4-chloropicolinate was directly transformed to 4-iodopicolinic acid in a good yield.
