18818-25-2 Usage
Description
5-FORMYL-2,4-DIMETHYLPYRROLE-3-PROPIONIC ACID, METHYL ESTER is a yellow crystalline solid that serves as an important precursor in the synthesis of Hemes and Porphyrins, which are essential components in various biological processes and have applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
5-FORMYL-2,4-DIMETHYLPYRROLE-3-PROPIONIC ACID, METHYL ESTER is used as a key intermediate for the preparation of Hemes and Porphyrins, which are crucial in the development of drugs targeting various medical conditions. These compounds play a significant role in the structure and function of hemoglobin and other proteins involved in oxygen transport and electron transfer.
Used in Chemical Industry:
In the chemical industry, 5-FORMYL-2,4-DIMETHYLPYRROLE-3-PROPIONIC ACID, METHYL ESTER is utilized as a vital precursor for the synthesis of complex organic molecules, such as Hemes and Porphyrins. These molecules are essential in various applications, including the development of catalysts, sensors, and materials with unique optical and electronic properties.
Used in Research and Development:
5-FORMYL-2,4-DIMETHYLPYRROLE-3-PROPIONIC ACID, METHYL ESTER is also employed in research and development for the study of Hemes and Porphyrins, their properties, and their potential applications in various fields. This includes the investigation of their interactions with other molecules and the development of new methods for their synthesis and modification.
Check Digit Verification of cas no
The CAS Registry Mumber 18818-25-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,8,1 and 8 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 18818-25:
(7*1)+(6*8)+(5*8)+(4*1)+(3*8)+(2*2)+(1*5)=132
132 % 10 = 2
So 18818-25-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3/c1-7-9(4-5-11(14)15-3)8(2)12-10(7)6-13/h6,12H,4-5H2,1-3H3