202865-61-0 Usage
Description
4-Bromo-3,5-difluoroanisole is a chemical compound characterized by the presence of a bromine atom at the 4-position, and two fluorine atoms at the 3 and 5 positions on the anisole molecule. It is a clear slightly yellow liquid or white crystalline substance, known for its unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
4-Bromo-3,5-difluoroanisole is used as a key intermediate in the synthesis of difluorophenacyl analogs, which serve as inhibitors of cyclin-dependent kinases. These kinase inhibitors play a crucial role in regulating cell cycle progression and have potential applications in the development of anticancer drugs.
4-Bromo-3,5-difluoroanisole is also used as a starting material for the synthesis of aminopyridine N-oxides. These compounds exhibit selective inhibition of p38 MAP kinase, a protein kinase involved in various cellular processes, including inflammation, immune responses, and cell growth. The selective inhibition of p38 MAP kinase can be beneficial in the treatment of various inflammatory and autoimmune diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 202865-61-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,2,8,6 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 202865-61:
(8*2)+(7*0)+(6*2)+(5*8)+(4*6)+(3*5)+(2*6)+(1*1)=120
120 % 10 = 0
So 202865-61-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrFNO/c8-7-2-1-6(9)3-5(7)4-10-11/h1-4,11H/b10-4+
