2139-47-1 Usage
Description
1,5-DIMETHYL-4-NICOTINAMIDO-2-PHENYL-3-PYRAZOLONE is a chemical compound with the molecular formula C16H16N4O. It is a derivative of pyrazolone, a heterocyclic organic compound, and features a nicotinamide group attached to the 4-position and a phenyl group at the 2-position. 1,5-DIMETHYL-4-NICOTINAMIDO-2-PHENYL-3-PYRAZOLONE has potential applications in various fields due to its unique structure and properties.
Uses
Used in Pharmaceutical Industry:
1,5-DIMETHYL-4-NICOTINAMIDO-2-PHENYL-3-PYRAZOLONE is used as an analgesic and anti-inflammatory agent for the treatment of various rheumatic conditions. Its structure allows it to exhibit pain-relieving and inflammation-reducing properties, making it a valuable drug in the management of chronic pain and inflammation associated with rheumatic diseases.
Used in Drug Development:
1,5-DIMETHYL-4-NICOTINAMIDO-2-PHENYL-3-PYRAZOLONE can be further studied and modified for the development of new drugs with improved efficacy and reduced side effects. Its unique structure provides a basis for the design of novel therapeutic agents that can target specific biological pathways and address unmet medical needs.
Check Digit Verification of cas no
The CAS Registry Mumber 2139-47-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,3 and 9 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2139-47:
(6*2)+(5*1)+(4*3)+(3*9)+(2*4)+(1*7)=71
71 % 10 = 1
So 2139-47-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N4O2/c1-12-15(19-16(22)13-7-6-10-18-11-13)17(23)21(20(12)2)14-8-4-3-5-9-14/h3-11H,1-2H3,(H,19,22)