2160-55-6 Usage
Description
1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE is a chemical compound characterized by its molecular formula C6H4BrNO3S. It is a yellow solid with a molecular weight of 249.07 g/mol. 1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE is known for its unique structure, which includes a bromo-nitro-thienyl group attached to an ethanone backbone. This structure endows it with potential as an intermediate for a variety of organic reactions. Furthermore, the presence of bromine, nitro, and thienyl functional groups makes it a versatile chemical for use in medicinal chemistry and material science applications. Its synthesis and properties make it a valuable tool in the development of new pharmaceuticals and advanced materials.
Uses
Used in Organic Synthesis:
1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE is used as a building block in organic synthesis for its ability to participate in various organic reactions due to its unique structure and functional groups.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE is used as an intermediate in the development of new pharmaceuticals. Its versatile chemical structure allows for its use in creating novel drug candidates.
Used in Medicinal Chemistry:
1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE is utilized in medicinal chemistry for its potential to be modified and functionalized to create compounds with specific biological activities.
Used in Material Science:
In the field of material science, 1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE is used for its potential in the development of advanced materials, taking advantage of its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 2160-55-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,6 and 0 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2160-55:
(6*2)+(5*1)+(4*6)+(3*0)+(2*5)+(1*5)=56
56 % 10 = 6
So 2160-55-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H4BrNO3S/c1-3(9)5-2-4(8(10)11)6(7)12-5/h2H,1H3
