226703-16-8 Usage
General Description
2-Cyclopenten-1-one, 2-bromo-3-ethoxy-(9CI) is a chemical compound, which appears to derive from cyclopentenone, a cyclic ketone, with a bromine atom and an ethoxy group attached via carbon atoms. The term '9CI' indicates that this is the ninth collective index that names and facilitates the identification of chemical substances from the complex scientific and patent literature. 2-Cyclopenten-1-one,2-bromo-3-ethoxy-(9CI) could potentially be used in numerous chemical reactions as a substrate, but the exact properties, such as boiling point, melting point, and toxicity, are not specified, suggesting that information about this compound might be scarce or specific to certain scientific contexts. Overall, it might contribute to organic chemistry research and development, especially in creating new materials or drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 226703-16-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,2,6,7,0 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 226703-16:
(8*2)+(7*2)+(6*6)+(5*7)+(4*0)+(3*3)+(2*1)+(1*6)=118
118 % 10 = 8
So 226703-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9BrO2/c1-2-10-6-4-3-5(9)7(6)8/h2-4H2,1H3