25151-07-9 Usage
Description
5-chloro-2,4-difluoropyrimidine is an organic compound that serves as a synthetic intermediate in the pharmaceutical industry. It is characterized by its unique molecular structure, which includes a pyrimidine ring with a chlorine atom at the 5th position and two fluorine atoms at the 2nd and 4th positions. 5-chloro-2,4-difluoropyrimidine is known for its potential applications in the development of various pharmaceutical products.
Uses
Used in Pharmaceutical Synthesis:
5-chloro-2,4-difluoropyrimidine is used as a synthetic intermediate for the development of various pharmaceutical goods. Its unique molecular structure allows it to be a key component in the synthesis of a wide range of medications, contributing to the advancement of healthcare and the treatment of various diseases.
In the pharmaceutical industry, 5-chloro-2,4-difluoropyrimidine is used as a building block for the creation of new drugs. Its chemical properties make it a valuable asset in the design and synthesis of novel therapeutic agents, potentially leading to the development of more effective treatments for a variety of medical conditions.
Additionally, 5-chloro-2,4-difluoropyrimidine may also be utilized in the research and development of new drug candidates, as its unique structure can provide insights into the design of more potent and selective medications. This can ultimately contribute to the improvement of drug efficacy and the reduction of side effects, benefiting patients and the healthcare system as a whole.
Check Digit Verification of cas no
The CAS Registry Mumber 25151-07-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,1,5 and 1 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 25151-07:
(7*2)+(6*5)+(5*1)+(4*5)+(3*1)+(2*0)+(1*7)=79
79 % 10 = 9
So 25151-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C4HClF2N2/c5-2-1-8-4(7)9-3(2)6/h1H
25151-07-9Relevant articles and documents
Aromatic C-F activation at Ni in the presence of a carbon-chlorine bond: The nickel mediated synthesis of new pyrimidines
Sladek, Marianna I.,Braun, Thomas,Neumann, Beate,Stammler, Hans-Georg
, p. 297 - 299 (2007/10/03)
Treatment of [Ni(COD)2]/PCy3 with 5-chloro-2,4,6-trifluoropyrimidine affords the C-F activation product trans-[NiF(4-C4N2ClF2)(PCy3) 2] 2, which reacts with iodine to form 5-chloro-2,6-difluoro-4-iodo-pyrimidine 5.
