259683-56-2 Usage
General Description
1-(2-FORMYLPHENYL)PIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER is a complex chemical compound. It belongs to the phenylpiperidines class of organic compounds, which are comprised of a piperidine ring that is substituted with one or more phenyl groups. This specific compound features an ethyl ester functional group and a formyl group on the phenyl ring, which both contribute to its overall molecular characteristics and reactivity. Its potential uses and effects largely depend on the context of its application, such as synthesis of other compounds, lab research, or industry application. It also carries inherent hazards associated with handling, storage, and disposal due to its particular chemical qualities. Detailed information about its physical/chemical properties, toxicological or ecotoxicological implications is usually given by its Safety Data Sheet (SDS).
Check Digit Verification of cas no
The CAS Registry Mumber 259683-56-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,9,6,8 and 3 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 259683-56:
(8*2)+(7*5)+(6*9)+(5*6)+(4*8)+(3*3)+(2*5)+(1*6)=192
192 % 10 = 2
So 259683-56-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NO3/c1-2-19-15(18)12-7-9-16(10-8-12)14-6-4-3-5-13(14)11-17/h3-6,11-12H,2,7-10H2,1H3
259683-56-2Relevant articles and documents
NOVEL IMIDAZOLE COMPOUND AND USE THEREOF AS MELANOCORTIN RECEPTOR AGONIST
-
Paragraph 0502, (2018/10/04)
The present invention relates to a novel imidazole compound or a pharmaceutically acceptable salt thereof having a melanocortin receptor agonistic activity, and medical use thereof. The present invention relates to an imidazole compound represented by general formula [I] [wherein: Ring A represents an optionally substituted aryl group or the like; R1 represents a hydrogen atom, an optionally substituted alkyl group, or the like; R2 represents a hydrogen atom, a halogen atom, or the like; and R3 represents an optionally substituted alkyl group] or a pharmaceutically acceptable salt thereof.
