773870-63-6 Usage
General Description
The chemical "1-(2-HYDROXYMETHYLPHENYL)PIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER" is a compound that belongs to the piperidine class of chemicals. It has a structure that consists of a piperidine ring attached to a carboxylic acid ethyl ester group and a hydroxymethylphenyl group. This chemical may have potential pharmaceutical applications due to its structural features, such as its piperidine ring, which is a common structural motif in many pharmaceutical compounds. The presence of a hydroxymethylphenyl group may also impart specific biological activity to the molecule. Additionally, the carboxylic acid ethyl ester group in the compound suggests that it may have potential as a prodrug, meaning it could be metabolized in the body to produce the active pharmaceutical compound. Overall, this chemical compound represents an interesting target for further research and development in the pharmaceutical field.
Check Digit Verification of cas no
The CAS Registry Mumber 773870-63-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 7,7,3,8,7 and 0 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 773870-63:
(8*7)+(7*7)+(6*3)+(5*8)+(4*7)+(3*0)+(2*6)+(1*3)=206
206 % 10 = 6
So 773870-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H21NO3/c1-2-19-15(18)12-7-9-16(10-8-12)14-6-4-3-5-13(14)11-17/h3-6,12,17H,2,7-11H2,1H3
773870-63-6Relevant articles and documents
NOVEL IMIDAZOLE COMPOUND AND USE THEREOF AS MELANOCORTIN RECEPTOR AGONIST
-
Paragraph 0502, (2018/10/04)
The present invention relates to a novel imidazole compound or a pharmaceutically acceptable salt thereof having a melanocortin receptor agonistic activity, and medical use thereof. The present invention relates to an imidazole compound represented by general formula [I] [wherein: Ring A represents an optionally substituted aryl group or the like; R1 represents a hydrogen atom, an optionally substituted alkyl group, or the like; R2 represents a hydrogen atom, a halogen atom, or the like; and R3 represents an optionally substituted alkyl group] or a pharmaceutically acceptable salt thereof.
