336-34-5 Usage
Description
1-CHLORO-3,3,4,4,5,5-HEXAFLUORO-2-METHOXYCYCLOPENTENE is an organic compound characterized by its unique structure, which includes a cyclopentene ring with a chloro group, a methoxy group, and six fluoro substituents. 1-CHLORO-3,3,4,4,5,5-HEXAFLUORO-2-METHOXYCYCLOPENTENE is known for its versatile chemical properties and potential applications in various industries.
Uses
Used in the Chemical Industry:
1-CHLORO-3,3,4,4,5,5-HEXAFLUORO-2-METHOXYCYCLOPENTENE is used as an intermediate in the synthesis of perhalocyclopentanones, which are valuable compounds in the chemical industry due to their unique properties and potential applications in various fields.
Used in the Dye Industry:
1-CHLORO-3,3,4,4,5,5-HEXAFLUORO-2-METHOXYCYCLOPENTENE is also used in the preparation of tetracarbocyanine dyes with fluorinated rings in the side chain. These dyes are known for their distinctive color properties and are utilized in various applications, such as in the production of pigments, inks, and other colorants.
Check Digit Verification of cas no
The CAS Registry Mumber 336-34-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,3 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 336-34:
(5*3)+(4*3)+(3*6)+(2*3)+(1*4)=55
55 % 10 = 5
So 336-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO3S/c1-3-16(14)8-9-6-4-5-7-10(9)15-11(13)12-2/h4-7H,3,8H2,1-2H3,(H,12,13)