33795-85-6 Usage
Description
N-METHYLTETRAFLUOROPHTHALIMIDE is an organic compound with the chemical formula C10H5F4NO2. It is characterized by its unique structure, which includes fluorine atoms and a phthalimide group. N-METHYLTETRAFLUOROPHTHALIMIDE is known for its potential applications in various industries due to its specific properties.
Uses
Used in the Electrochemical Industry:
N-METHYLTETRAFLUOROPHTHALIMIDE is used as a nonaqueous electrolyte for enhancing the performance of electrochemical devices. Its application reason is attributed to its ability to improve the ionic conductivity and stability of the electrolyte, which in turn can lead to better overall performance of the device.
Used in the Energy Storage Industry:
N-METHYLTETRAFLUOROPHTHALIMIDE is used as a component in lithium-ion secondary batteries. The application reason is its potential to increase the energy density and cycle life of the batteries, making them more efficient and durable for various energy storage applications.
Check Digit Verification of cas no
The CAS Registry Mumber 33795-85-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,3,7,9 and 5 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 33795-85:
(7*3)+(6*3)+(5*7)+(4*9)+(3*5)+(2*8)+(1*5)=146
146 % 10 = 6
So 33795-85-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H3F4NO2/c1-14-8(15)2-3(9(14)16)5(11)7(13)6(12)4(2)10/h1H3
