34570-16-6 Usage
Description
ETHYL 3-AMINO-3-ETHOXYACRYLATE HYDROCHLORIDE is an organic compound that serves as a key intermediate in the synthesis of various chemical compounds. It is characterized by its reactivity and functional groups, which make it a versatile building block in the field of chemical synthesis.
Uses
Used in Pharmaceutical Industry:
ETHYL 3-AMINO-3-ETHOXYACRYLATE HYDROCHLORIDE is used as a reagent for the synthesis of pyridine carboxamides, which are known as c-Jun NH2-terminal kinase (JNK) inhibitors. These inhibitors play a crucial role in regulating cellular processes such as cell proliferation, apoptosis, and immune responses. By targeting JNK, these compounds have potential applications in the treatment of various diseases, including neurodegenerative disorders, inflammatory conditions, and cancer.
Used in Chemical Synthesis:
ETHYL 3-AMINO-3-ETHOXYACRYLATE HYDROCHLORIDE is also used in chemical synthesis for the production of various compounds with diverse applications. Its unique structure and reactivity make it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals. ETHYL 3-AMINO-3-ETHOXYACRYLATE HYDROCHLORIDE's versatility allows for the development of new molecules with potential applications in various industries, contributing to the advancement of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 34570-16-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,4,5,7 and 0 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 34570-16:
(7*3)+(6*4)+(5*5)+(4*7)+(3*0)+(2*1)+(1*6)=106
106 % 10 = 6
So 34570-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO3.ClH/c1-3-10-6(8)5-7(9)11-4-2;/h5H,3-4,8H2,1-2H3;1H/b6-5-;
34570-16-6Relevant articles and documents
Synthesis of novel nicotinohydrazide and (1,3,4-oxadiazol-2-yl)-6-(trifluoromethyl)pyridine derivatives as potential anticancer agents
Naresh Kumar,Poornachandra,Nagender,Santhosh Kumar,Krishna Swaroop,Ganesh Kumar,Narsaiah
, p. 4829 - 4831 (2016)
A series of novel nicotinohydrazide derivatives 6a–g and 1,3,4-oxadiazole functionalized pyridine derivatives 7a–k and 8a–d were prepared in series of steps. All the compounds were screened for cytotoxicity against HeLa (cervical), DU145 (prostate), HepG2
Pyrimidinecarbamate derivatives as intermediates
-
, (2008/06/13)
2,4-Disubstituted 6-[3,6-dihydro-1(2H)-pyridyl]pyrimidine-3-oxides of the formula STR1 wherein R1 is lower alkyl or lower alkoxy-lower alkyl, R2 is hydrogen or --COOR3 wherein R3 is lower alkyl or lower alkoxy-l