3646-28-4 Usage
Description
ESTRENONE, also known as Estr-4-en-17-one, is an organic compound that serves as an impurity in Allylestrenol. It is a steroidal compound with a molecular structure that makes it a valuable intermediate in the synthesis of various pharmaceuticals and steroids.
Uses
Used in Pharmaceutical Industry:
ESTRENONE is used as an intermediate in the synthesis of Ethylestrenol (E917830), which is an anabolic steroid. It plays a crucial role in the development of performance-enhancing drugs and medications that target hormonal imbalances and muscle growth.
Used in Steroid Synthesis:
In the field of steroid synthesis, ESTRENONE is utilized as a key component for creating various steroidal compounds. Its unique structure allows for the development of new steroids with potential applications in medicine and sports performance enhancement.
Check Digit Verification of cas no
The CAS Registry Mumber 3646-28-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,6,4 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 3646-28:
(6*3)+(5*6)+(4*4)+(3*6)+(2*2)+(1*8)=94
94 % 10 = 4
So 3646-28-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H26O/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19/h4,13-16H,2-3,5-11H2,1H3/t13-,14+,15+,16-,18-/m0/s1