40400-15-5 Usage
Description
2-Iodophenylacetonitrile is a 2-aryl substituted nitrile that is known for its reactivity with lactams to form ring-fused isoquinolinones through a palladium-catalyzed carboxamidation process in tandem with aldol condensation. This organic compound is characterized by its unique chemical structure and properties, making it a versatile building block in the synthesis of various organic molecules.
Uses
Used in Pharmaceutical Industry:
2-Iodophenylacetonitrile is used as a synthetic intermediate for the preparation of various pharmaceutical compounds. Its ability to react with lactams to form ring-fused isoquinolinones makes it a valuable component in the development of new drugs and therapeutic agents.
Used in Chemical Synthesis:
2-Iodophenylacetonitrile is used as a key building block in the synthesis of various organic compounds, including:
1. 2?-aminobiphen-2-ylacetonitrile
2. Ethyl (2-iodophenyl)iminoacetate hydrochloride
3. 3,4-disubstituted 2-naphthalenamines
These compounds have potential applications in various fields, such as pharmaceuticals, agrochemicals, and materials science.
Used in the Preparation of Nitriles:
2-Iodophenylacetonitrile is also utilized in the preparation of several nitriles, which are important intermediates in the synthesis of various organic compounds. Some of these nitriles include:
1. 2-(2-iodophenyl)-2-methylpropanenitrile
2. 1-(2-iodophenyl)cyclopentanecarbonitrile
3. 5-bromo-2-(2-iodophenyl)pentanenitrile
4. 2-(2-iodophenyl)-2-propylpentanenitrile
5. 1-(2-iodophenyl)cyclohexanecarbonitrile
6. 1-(2-Iodophenyl)cyclopropanecarbonitrile
These nitriles can be further modified and used in the development of new compounds with potential applications in various industries, such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 40400-15-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,4,0 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 40400-15:
(7*4)+(6*0)+(5*4)+(4*0)+(3*0)+(2*1)+(1*5)=55
55 % 10 = 5
So 40400-15-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2
40400-15-5Relevant articles and documents
Long-Lived, Strongly Emissive, and Highly Reducing Excited States in Mo(0) Complexes with Chelating Isocyanides
Herr, Patrick,Glaser, Felix,Büldt, Laura A.,Larsen, Christopher B.,Wenger, Oliver S.
supporting information, p. 14394 - 14402 (2019/10/11)
Newly discovered tris(diisocyanide)molybdenum(0) complexes are Earth-abundant isoelectronic analogues of the well-known class of [Ru(α-diimine)3]2+ compounds with long-lived 3MLCT (metal-to-ligand charge transfer) excited
Palladium-Catalyzed, ortho-Selective C-H Halogenation of Benzyl Nitriles, Aryl Weinreb Amides, and Anilides
Das, Riki,Kapur, Manmohan
, p. 1114 - 1126 (2018/06/18)
A palladium-catalyzed, ortho-selective C-H halogenation methodology is reported herein. The highlight of the work is the highly selective C(sp2)-H functionalization of benzyl nitriles in the presence of activated C(sp3)-H bond, which results in good yields of the halogenated products with excellent regioselectivity. Along with benzyl nitriles, aryl Weinreb amides and anilides have been evaluated for the transformation using aprotic conditions. Mechanistic studies yield interesting aspects with respect to the pathway of the reaction and the directing group abilities.
