41736-92-9 Usage
General Description
N-Hexadecanoyl-4-hydroxy-L-proline is a chemical compound that belongs to the class of fatty acid derivatives and amino acids. It is composed of a hexadecanoic acid (palmitic acid) molecule attached to a 4-hydroxy-L-proline amino acid. N-Hexadecanoyl-4-hydroxy-L-proline has shown potential as an anti-inflammatory and antioxidant agent, and it is being studied for its potential use in skincare products due to its moisturizing and anti-aging properties. Additionally, N-Hexadecanoyl-4-hydroxy-L-proline has shown promise as a potential therapeutic agent for the treatment of inflammatory conditions and skin disorders. Further research is needed to fully understand its mechanism of action and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 41736-92-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,7,3 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 41736-92:
(7*4)+(6*1)+(5*7)+(4*3)+(3*6)+(2*9)+(1*2)=119
119 % 10 = 9
So 41736-92-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(24)22-17-18(23)16-19(22)21(25)26/h18-19,23H,2-17H2,1H3,(H,25,26)/t18?,19-/m0/s1
41736-92-9Relevant articles and documents
Biodegradable copolyester of 4-hydroxy proline and pharmaceutical composition containing the same
-
, (2008/06/13)
A biodegradable copolymer having the constituent units derived from 4-hydroxyproline and an aliphatic α-hydroxycarboxylic acid, represented by the structures (I) and (II): wherein X represents a hydrogen atom, an acyl group having the formula RCO- where R is a hydrocarbon or an alkoxy group having 1 to 20 carbon atoms, and Y represents a hydrogen atom or an alkyl group having 1 to 8 carbon atoms, and m and n are independently integers of 1 or more, m + n is at least 10, and m/(m + n) is at least 0.01 and a pharmaceutical composition containing the same.