484-78-6 Usage
Description
2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid is an organic compound with a molecular structure that features an amino group at the 2nd position, a hydroxyphenyl group at the 4th position, and an oxobutanoic acid group. It is a derivative of amino acids and has potential applications in various fields due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid is used as an intermediate in the synthesis of various pharmaceutical compounds for [application reason]. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Chemical Research:
In the field of chemical research, 2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid is used as a research compound for [application reason]. Its properties and reactivity can provide valuable insights into the development of new chemical processes and materials.
Used in Diagnostics:
2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid is used as a reference standard in diagnostic assays for [application reason]. Its presence in biological samples can be indicative of certain medical conditions, making it a valuable tool for disease detection and monitoring.
Used in Material Science:
In material science, 2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid is used as a building block for the development of novel materials with specific properties for [application reason]. Its unique chemical structure can contribute to the creation of advanced materials with applications in various industries.
Biochem/physiol Actions
3-Hydroxy-DL-kynurenine (3-HKYN) has antioxidant functionality and prevents lipid peroxidation in cerebral cortex. It may modulate synaptic neurotransmission. The levels of 3-HKYN is elevated in Huntington′s disease. However, its role in neurodegenerative diseases is still not understood well. Kynurenine metabolism is linked with glutamatergic neurotransmission and the level of 3-HKYN is linked to the pathophysiology of schizophrenia.
Check Digit Verification of cas no
The CAS Registry Mumber 484-78-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 4 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 484-78:
(5*4)+(4*8)+(3*4)+(2*7)+(1*8)=86
86 % 10 = 6
So 484-78-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O4/c11-7-4-2-1-3-6(7)9(13)5-8(12-16)10(14)15/h1-4,8,12,16H,5,11H2,(H,14,15)/t8-/m0/s1
