552-14-7 Usage
Description
4-methyl-3-hydroxyanthranilic acid, also known as 4-Methyl-3-hydroxyanthranilic acid, is an aminobenzoic acid derivative characterized by the presence of a hydroxy group at the 3rd position and a methyl group at the 4th position. It is a naturally occurring compound with potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
4-methyl-3-hydroxyanthranilic acid is used as an intermediate in the synthesis of various pharmaceutical compounds, particularly those with potential therapeutic applications. Its unique structure allows for the development of novel drugs targeting specific biological pathways.
Used in Chemical Research:
In the field of chemical research, 4-methyl-3-hydroxyanthranilic acid serves as a valuable compound for studying the properties and reactivity of aminobenzoic acid derivatives. It can be used to explore new synthetic routes and develop innovative chemical methodologies.
Used in Material Science:
The unique chemical structure of 4-methyl-3-hydroxyanthranilic acid makes it a potential candidate for the development of new materials with specific properties. It can be used in the design and synthesis of novel polymers, dyes, and other advanced materials with applications in various industries.
Used in Agricultural Industry:
4-methyl-3-hydroxyanthranilic acid may also find applications in the agricultural industry, particularly in the development of new pesticides or herbicides. Its unique chemical properties could be exploited to create more effective and environmentally friendly products for crop protection.
Check Digit Verification of cas no
The CAS Registry Mumber 552-14-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,5 and 2 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 552-14:
(5*5)+(4*5)+(3*2)+(2*1)+(1*4)=57
57 % 10 = 7
So 552-14-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO3/c1-4-2-3-5(8(11)12)6(9)7(4)10/h2-3,10H,9H2,1H3,(H,11,12)
552-14-7Relevant articles and documents
A four-enzyme pathway for 3,5-dihydroxy-4-methylanthranilic acid formation and incorporation into the antitumor antibiotic sibiromycin
Giessen, Tobias W.,Kraas, Femke I.,Marahiel, Mohamed A.
, p. 5680 - 5692 (2012/05/19)
The antitumor antibiotic sibiromycin belongs to the class of pyrrolo[1,4]benzodiazepines (PBDs) that are produced by a variety of actinomycetes. PBDs are sequence-specific DNA-alkylating agents and possess significant antitumor properties. Among them, sibiromycin, one of two identified glycosylated PBDs, displays the highest DNA binding affinity and the most potent antitumor activity. In this study, we report the elucidation of the precise reaction sequence leading to the formation and activation of the 3,5-dihydroxy-4-methylanthranilic acid building block found in sibiromycin, starting from the known metabolite 3-hydroxykynurenine (3HK). The investigated pathway consists of four enzymes, which were biochemically characterized in vitro. Starting from 3HK, the SAM-dependent methyltransferase SibL converts the substrate to its 4-methyl derivative, followed by hydrolysis through the action of the PLP-dependent kynureninase SibQ, leading to 3-hydroxy-4-methylanthranilic acid (3H4MAA) formation. Subsequently the NRPS didomain SibE activates 3H4MAA and tethers it to its thiolation domain, where it is hydroxylated at the C5 position by the FAD/NADH-dependent hydroxylase SibG yielding the fully substituted anthranilate moiety found in sibiromycin. These insights about sibiromycin biosynthesis and the substrate specificities of the biosynthetic enzymes involved may guide future attempts to engineer the PBD biosynthetic machinery and help in the production of PBD derivatives.