4923-87-9 Usage
Description
5-Bromobenzo[b]thiophene is a white solid with chemical properties that make it a valuable compound in the field of organic chemistry. It is characterized by its distinct structure, which includes a benzene ring fused to a thiophene ring with a bromine atom at the 5th position.
Uses
Used in Pharmaceutical Industry:
5-Bromobenzo[b]thiophene is used as a reactant for the preparation of 4-aminoquinolines and tetraoxanes, which are known for their antimalarial activity. These compounds are crucial in the development of new drugs to combat malaria, a disease that affects millions of people worldwide.
5-Bromobenzo[b]thiophene is used as a chemical intermediate for the synthesis of various pharmaceutical compounds, particularly those with potential applications in the treatment of malaria. Its unique structure and reactivity make it a valuable building block in the development of new drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 4923-87-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,9,2 and 3 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4923-87:
(6*4)+(5*9)+(4*2)+(3*3)+(2*8)+(1*7)=109
109 % 10 = 9
So 4923-87-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H