5085-07-4 Usage
Description
GLUTARALDEHYDE 2,4-DINITROPHENYLHYDRAZONE is a chemical compound that serves as an analytical standard in various applications, particularly in environmental analysis. It is known for its ability to form a hydrazone derivative with glutaraldehyde, which can be used for the detection and quantification of aldehydes and ketones in different samples.
Used in Environmental Analysis:
GLUTARALDEHYDE 2,4-DINITROPHENYLHYDRAZONE is used as an analytical standard for the detection and quantification of aldehydes and ketones in environmental samples. Its hydrazone derivative formation with glutaraldehyde allows for accurate measurements and assessments of these compounds in various environmental matrices.
Used in Dye Industry:
In the dye industry, GLUTARALDEHYDE 2,4-DINITROPHENYLHYDRAZONE is used as a precursor or intermediate in the synthesis of various dyes and pigments. Its unique chemical properties enable the development of dyes with specific characteristics, such as color, stability, and solubility.
Used in Metabolite Analysis:
GLUTARALDEHYDE 2,4-DINITROPHENYLHYDRAZONE is also utilized in metabolite analysis, where it can be employed as a derivatization agent for the detection and quantification of specific metabolites in biological samples. This application is particularly useful in research and diagnostic settings, where accurate identification and measurement of metabolites are crucial for understanding metabolic pathways and disease mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 5085-07-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,8 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5085-07:
(6*5)+(5*0)+(4*8)+(3*5)+(2*0)+(1*7)=84
84 % 10 = 4
So 5085-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N8O8/c26-22(27)12-4-6-14(16(10-12)24(30)31)20-18-8-2-1-3-9-19-21-15-7-5-13(23(28)29)11-17(15)25(32)33/h4-11,20-21H,1-3H2/b18-8+,19-9+