53527-07-4 Usage
Description
N-iodoacetyltyramine is a chemical compound that is utilized in the iodine-125 labeling process. It is known for its ability to effectively label various molecules, making it a valuable tool in the field of chemical analysis.
Uses
Used in Chemical Analysis:
N-iodoacetyltyramine is used as a labeling agent for the iodine-125 isotope, which is particularly useful in chemical analysis. The application reason is that it allows for the efficient and accurate labeling of different molecules, facilitating their detection and study in various research and diagnostic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 53527-07-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,5,2 and 7 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 53527-07:
(7*5)+(6*3)+(5*5)+(4*2)+(3*7)+(2*0)+(1*7)=114
114 % 10 = 4
So 53527-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H12INO2/c11-7-10(14)12-6-5-8-1-3-9(13)4-2-8/h1-4,13H,5-7H2,(H,12,14)