5388-62-5 Usage
Description
4-CHLORO-2,6-DINITROANILINE is an organic compound with the chemical formula C6H4ClN3O4. It is characterized by the presence of a chlorine atom at the 4th position, and two nitro groups (NO2) at the 2nd and 6th positions on a benzene ring. The standard molar enthalpy of formation for this compound has been evaluated, indicating its potential involvement in various chemical reactions and applications.
Uses
Used in Chemical Synthesis:
4-CHLORO-2,6-DINITROANILINE is used as a chemical intermediate for the synthesis of various compounds, particularly in the pharmaceutical and agrochemical industries. Its unique structure with a chlorine atom and nitro groups allows for further functionalization and modification to create a range of derivative products.
Used in Explosives Manufacturing:
Due to its high energy content and reactivity, 4-CHLORO-2,6-DINITROANILINE can be used as a component in the manufacturing of explosives. Its ability to undergo rapid decomposition upon initiation makes it a valuable contributor to the overall performance of certain explosive formulations.
Used in Dye Production:
4-CHLORO-2,6-DINITROANILINE's characteristic structure and reactivity also make it suitable for use in the production of dyes, particularly those requiring specific color properties and stability. Its versatility in chemical reactions allows for the creation of a variety of dyes with different shades and characteristics.
Used in Research and Development:
4-CHLORO-2,6-DINITROANILINE serves as a valuable research tool in the field of organic chemistry, particularly in the study of aromatic compounds and their reactions. Its unique properties and reactivity make it an interesting subject for exploring new synthetic pathways and understanding the underlying chemical mechanisms.
Check Digit Verification of cas no
The CAS Registry Mumber 5388-62-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,8 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5388-62:
(6*5)+(5*3)+(4*8)+(3*8)+(2*6)+(1*2)=115
115 % 10 = 5
So 5388-62-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClN3O4/c7-3-1-4(9(11)12)6(8)5(2-3)10(13)14/h1-2H,8H2
