5425-39-8 Usage
Description
[(2,5-dichlorothiophen-3-yl)methylideneamino]thiourea, a chemical compound with the molecular formula C7H5Cl2N3S, is a derivative of thiourea featuring a substituted thiophene ring. [(2,5-dichlorothiophen-3-yl)methylideneamino]thiourea holds promise in the field of medicinal chemistry due to its potential as an antifungal and antibacterial agent. Its unique structure and properties make it a candidate for further research and development within the pharmaceutical industry. Additionally, it can serve as a building block in the synthesis of various organic compounds. However, it is crucial to handle and use this compound with caution, adhering to proper safety measures and protocols.
Uses
Used in Pharmaceutical Industry:
[(2,5-dichlorothiophen-3-yl)methylideneamino]thiourea is used as a potential antifungal and antibacterial agent for its demonstrated effectiveness against various fungi and bacteria. Its unique structure allows for further research and development to enhance its pharmaceutical applications.
Used in Organic Synthesis:
In the field of organic chemistry, [(2,5-dichlorothiophen-3-yl)methylideneamino]thiourea serves as a valuable building block for the synthesis of a wide range of organic compounds. Its versatile structure enables the creation of new molecules with potential applications in various industries.
Used in Research and Development:
[(2,5-dichlorothiophen-3-yl)methylideneamino]thiourea is also utilized in research and development settings, where scientists explore its potential applications and properties further. The study of [(2,5-dichlorothiophen-3-yl)methylideneamino]thiourea can lead to the discovery of new drugs, materials, and technologies that benefit society.
Check Digit Verification of cas no
The CAS Registry Mumber 5425-39-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5425-39:
(6*5)+(5*4)+(4*2)+(3*5)+(2*3)+(1*9)=88
88 % 10 = 8
So 5425-39-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5Cl2N3S2/c7-4-1-3(5(8)13-4)2-10-11-6(9)12/h1-2H,(H3,9,11,12)/b10-2+