5636-65-7 Usage
Description
5-METHYL-4-HEXENOIC ACID, also known as 5-methylhex-4-enoic acid, is an organic compound with the chemical formula C7H12O2. It is a colorless liquid with a distinctive odor and is characterized by its carboxylic acid functional group. 5-METHYL-4-HEXENOIC ACID is known for its versatile chemical properties, making it a valuable intermediate in the synthesis of various chemical products.
Uses
Used in Pharmaceutical Industry:
5-METHYL-4-HEXENOIC ACID is used as a reactant for the preparation of 5-fluoromethyl-substituted γ-lactams, which are important intermediates in the synthesis of pharmaceutical compounds. These γ-lactams have potential applications in the development of new drugs, particularly in the treatment of various diseases and medical conditions.
Used in Chemical Synthesis:
In the field of chemical synthesis, 5-METHYL-4-HEXENOIC ACID serves as a key building block for the creation of a wide range of chemical products. Its unique structure allows for various chemical reactions, such as esterification, amidation, and halogenation, which can lead to the formation of diverse compounds with different applications.
Used in Flavor and Fragrance Industry:
Due to its distinctive odor, 5-METHYL-4-HEXENOIC ACID can be used as a component in the flavor and fragrance industry. It can be employed in the development of new scents for perfumes, cosmetics, and other consumer products, as well as in the creation of artificial flavors for the food and beverage industry.
Used in Research and Development:
5-METHYL-4-HEXENOIC ACID is also utilized in research and development laboratories for the study of its chemical properties and potential applications. Scientists and researchers can use this compound to explore new reaction pathways, develop novel synthetic methods, and investigate its potential as a precursor for the synthesis of other valuable chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 5636-65-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,3 and 6 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5636-65:
(6*5)+(5*6)+(4*3)+(3*6)+(2*6)+(1*5)=107
107 % 10 = 7
So 5636-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H12O2/c1-6(2)4-3-5-7(8)9/h4H,3,5H2,1-2H3,(H,8,9)