591-01-5 Usage
Description
Guanylurea sulfate is a white fine powder with unique chemical properties that make it suitable for various applications, particularly in the field of metal detection and separation.
Uses
Used in Metal Detection and Separation:
Guanylurea sulfate is used as a detection agent for identifying and determining the presence of nickel (Ni). It is particularly effective in separating nickel from cobalt (Co) and other metals, making it a valuable tool in the metallurgical and chemical industries for ensuring the purity and quality of metal products.
The specific application reason for Guanylurea sulfate in this context is its ability to selectively interact with nickel, allowing for accurate detection and efficient separation from other metals. This property is crucial in various industrial processes where the presence of specific metal impurities can significantly impact the performance and properties of the final product.
Check Digit Verification of cas no
The CAS Registry Mumber 591-01-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,9 and 1 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 591-01:
(5*5)+(4*9)+(3*1)+(2*0)+(1*1)=65
65 % 10 = 5
So 591-01-5 is a valid CAS Registry Number.
InChI:InChI=1/C2H6N4O.H2O4S/c3-1(4)6-2(5)7;1-5(2,3)4/h(H6,3,4,5,6,7);(H2,1,2,3,4)
