60788-02-5 Usage
General Description
"(2,5-DIOXO-1-PHENYL-PYRROLIDIN-3-YLSULFANYL)-ACETIC ACID" is a complex chemical compound with several distinctive components. The compound contains a phenyl group, a ring-shaped component that is common in many organic compounds, suggesting some degree of aromaticity and potential for interaction with other chemical structures. The pyrrolidin portion of the structure indicates the presence of a five-membered ring containing nitrogen, which may also suggest potential reactivity or stability concerns. The compound also contains acetic acid, a simple carboxylic acid. The sulfanyl group indicates the presence of sulfur, which can also contribute to the compound's overall reactivity. This particular chemical compound could potentially have various applications in different chemical reactions given the different functional groups it contains. However, additional study would be required to confirm potential uses or implications.
Check Digit Verification of cas no
The CAS Registry Mumber 60788-02-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,7,8 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 60788-02:
(7*6)+(6*0)+(5*7)+(4*8)+(3*8)+(2*0)+(1*2)=135
135 % 10 = 5
So 60788-02-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11NO4S/c14-10-6-9(18-7-11(15)16)12(17)13(10)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,15,16)
