61636-28-0 Usage
Description
3-(2-AMINO-1,3-THIAZOL-4-YL)-2H-CHROMEN-2-ONE HYDROBROMIDE is a chemical compound characterized by its unique molecular structure, which features a 2H-chromen-2-one core with a 2-amino-1,3-thiazol-4-yl group attached at the 3-position. 3-(2-AMINO-1,3-THIAZOL-4-YL)-2H-CHROMEN-2-ONE HYDROBROMIDE is of interest due to its potential applications in various fields, particularly in the pharmaceutical industry.
Uses
Used in Pharmaceutical Industry:
3-(2-AMINO-1,3-THIAZOL-4-YL)-2H-CHROMEN-2-ONE HYDROBROMIDE is used as a key intermediate for the synthesis of histone deacetylase inhibitors with antifibrotic activity. These inhibitors play a crucial role in modulating gene expression and have potential therapeutic applications in treating fibrosis-related diseases.
Used in Research and Development:
In the field of research and development, 3-(2-AMINO-1,3-THIAZOL-4-YL)-2H-CHROMEN-2-ONE HYDROBROMIDE serves as a valuable compound for exploring its chemical properties, reactivity, and potential interactions with other molecules. This can lead to the discovery of new drug candidates and therapeutic strategies.
Used in Chemical Synthesis:
3-(2-AMINO-1,3-THIAZOL-4-YL)-2H-CHROMEN-2-ONE HYDROBROMIDE can be utilized as a building block in the synthesis of various complex organic molecules, including those with potential biological activities. Its unique structure makes it an attractive candidate for the development of novel compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 61636-28-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,6,3 and 6 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 61636-28:
(7*6)+(6*1)+(5*6)+(4*3)+(3*6)+(2*2)+(1*8)=120
120 % 10 = 0
So 61636-28-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2O2S/c13-12-14-9(6-17-12)8-5-7-3-1-2-4-10(7)16-11(8)15/h1-6H,(H2,13,14)