63071-13-6 Usage
Description
4-CHLOROPICOLINALDEHYDE, also known as 4-Chloro-2-pyridinecarboxaldehyde, is an organic compound that serves as a valuable synthetic intermediate in the chemical industry. It is characterized by its unique chemical structure, which features a chloro substituent on the 4-position of the picolinaldehyde backbone. This structural feature endows 4-CHLOROPICOLINALDEHYDE with specific reactivity and properties that make it suitable for a range of applications.
Uses
Used in Pharmaceutical Industry:
4-CHLOROPICOLINALDEHYDE is used as a synthetic intermediate for the development of various pharmaceutical compounds. Its unique structure allows for the creation of novel molecules with potential therapeutic applications, contributing to the advancement of drug discovery and development.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-CHLOROPICOLINALDEHYDE is used as a key building block for the production of complex organic molecules. Its reactivity and functional groups enable the formation of a wide range of compounds, including 2,2''-bipyridines, (chloropyridyl)(pyridyl)ethylamine, and aryl and heteroaryl fluoromethyl ketones. These synthesized products find applications in various industries, such as agriculture, materials science, and pharmaceuticals.
Used in Research and Development:
4-CHLOROPICOLINALDEHYDE is also utilized in research and development laboratories for the exploration of new chemical reactions and the synthesis of novel compounds. Its unique properties make it an attractive candidate for studying reaction mechanisms, developing new synthetic methods, and discovering innovative applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 63071-13-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,0,7 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 63071-13:
(7*6)+(6*3)+(5*0)+(4*7)+(3*1)+(2*1)+(1*3)=96
96 % 10 = 6
So 63071-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClNO/c7-5-1-2-8-6(3-5)4-9/h1-4H
63071-13-6Relevant articles and documents
DINUCLEATING LIGAND OR DINUCLEAR METAL COMPLEX
-
, (2021/03/19)
To provide a dinuclear metal complex that can be synthesized simply and easily and has a proper anticancer action.SOLUTION: The present disclosure provides a dinucleating ligand represented by the following formula (I) and a dinuclear metal complex thereof (where each X may be the same or different to represent H, Cl, OMe, or, Me, Y is H, a phenyl group, a substituted carbamoyl group or the like).SELECTED DRAWING: None
A Transition-Metal-Free One-Pot Cascade Process for Transformation of Primary Alcohols (RCH2OH) to Nitriles (RCN) Mediated by SO2F2
Jiang, Ying,Sun, Bing,Fang, Wan-Yin,Qin, Hua-Li
supporting information, p. 3190 - 3194 (2019/05/21)
A new transition-metal-free one-pot cascade process for the direct conversion of alcohols to nitriles was developed without introducing an “additional carbon atom”. This protocol allows transformations of readily available, inexpensive, and abundant alcohols to highly valuable nitriles.
NOVEL MORPHOLINE DERIVATIVE OR SALT THEREOF
-
, (2016/07/05)
There is provided a morpholine derivative represented by General Formula [1A] or a salt thereof. (In the formula, a ring A represents a ring represented by General Formula [I]; * represents a bonding position; Z2 represents CH or the like; Z1 represents CR6 or the like; R6 represents a hydrogen atom or the like; X1 represents CHR7 or the like; R7 represents a hydrogen atom or the like; X2 represents CH2 or the like; R1 and R2 are the same as or different from each other, and each of R1 and R2 represents a hydrogen atom or the like; R3, R4, and R5 are the same as or different from each other, and each of R3, R4, and R5 represents a hydrogen atom, NRaRb, or the like; and each of Ra and Rb represents a hydrogen atom, a C1-8 alkyl group which may have a substituent, or the like.)
