63704-54-1 Usage
Description
2H-Cyclopenta[b]pyridin-2-one,4-amino-1,5,6,7-tetrahydro-(9CI) is a chemical compound with the molecular formula C9H11NO. It is a tetrahydro derivative of pyridine, featuring a cyclic structure with a five-membered ring fused to a six-membered ring. 2H-Cyclopenta[b]pyridin-2-one,4-amino-1,5,6,7-tetrahydro-(9CI) has an amino group (-NH2) attached to the four-carbon atom, making it a 4-amino tetrahydro derivative. Its unique structure and properties may offer potential applications in the pharmaceutical and chemical industries, with further research and development needed to explore its full potential in various fields.
Uses
Used in Pharmaceutical Industry:
2H-Cyclopenta[b]pyridin-2-one,4-amino-1,5,6,7-tetrahydro-(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a promising candidate for the development of new drugs, particularly in the areas of medicinal chemistry and drug design.
Used in Chemical Industry:
In the chemical industry, 2H-Cyclopenta[b]pyridin-2-one,4-amino-1,5,6,7-tetrahydro-(9CI) can be utilized as a building block for the creation of complex organic molecules and materials. Its versatile structure and functional groups make it suitable for use in the synthesis of specialty chemicals, agrochemicals, and other advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 63704-54-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,7,0 and 4 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 63704-54:
(7*6)+(6*3)+(5*7)+(4*0)+(3*4)+(2*5)+(1*4)=121
121 % 10 = 1
So 63704-54-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O/c9-6-4-8(11)10-7-3-1-2-5(6)7/h4H,1-3H2,(H3,9,10,11)