699-90-1 Usage
Description
3-Fluoro-2-methylbenzoic acid is an aryl fluorinated building block, characterized by its off-white powder form. It is a synthetic organic compound that features a fluorine atom attached to a benzene ring, with a methyl group at the 2nd position and a carboxyl group at the 1st position. This unique structure endows it with specific chemical properties that make it valuable in various applications.
Uses
Used in Analytical Chemistry:
3-Fluoro-2-methylbenzoic acid is used as a reference compound in the GC-MS (Gas Chromatography-Mass Spectrometry) detection of metabolites from cell cultures containing 6-fluoro-3-methylphenol. Its distinct chemical properties allow for accurate identification and quantification of related metabolites in complex biological samples, aiding in the study of metabolic pathways and the development of diagnostic methods.
Used in Pharmaceutical Industry:
As an aryl fluorinated building block, 3-Fluoro-2-methylbenzoic acid is utilized in the synthesis of various pharmaceutical compounds. The presence of the fluorine atom can significantly influence the pharmacokinetics, such as lipophilicity and metabolic stability, as well as the pharmacodynamics, including binding affinity and selectivity of the resulting drug molecules. This makes it a valuable intermediate in the development of new drugs with improved therapeutic properties.
Used in Chemical Research:
3-Fluoro-2-methylbenzoic acid serves as a key intermediate in the synthesis of a wide range of organic compounds for research purposes. Its unique structure allows chemists to explore various synthetic routes and reaction mechanisms, contributing to the advancement of organic chemistry and the discovery of novel chemical entities with potential applications in various fields.
Used in Material Science:
The aryl fluorinated structure of 3-Fluoro-2-methylbenzoic acid makes it a candidate for the development of new materials with specific properties. For instance, it can be incorporated into the design of polymers, coatings, or other materials with tailored characteristics, such as improved thermal stability, chemical resistance, or specific optical properties, depending on the intended application.
Check Digit Verification of cas no
The CAS Registry Mumber 699-90-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,9 and 9 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 699-90:
(5*6)+(4*9)+(3*9)+(2*9)+(1*0)=111
111 % 10 = 1
So 699-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H7FO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4H,1H3,(H,10,11)
699-90-1Relevant articles and documents
PROCESS FOR PRODUCING TOLUENE DERIVATIVES
-
, (2008/06/13)
A toluene derivative of the general formula (2) wherein R denotes a fluorine atom, a chlorine atom, an alkoxy group, or an alkylthio group, and X denotes a halogen atom, is prepared by reacting metallic magnesium with a 2-chloro-6-substituted toluene derivative of the general formula (1) wherein R is as defined above, in an ethereal solvent in the presence of a lower alkyl bromide.
